CAS 24554-26-5 is the registry number for FANFT. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-(5-nitrofuran-2-yl)-1,3-thiazol-2-yl]formamide (CAS 24554-26-5) is a chemical compound with the molecular formula C8H5N3O4S and a molecular weight of 239.21 g/mol. IUPAC name: N-[4-(5-nitrofuran-2-yl)-1,3-thiazol-2-yl]formamide. InChIKey: ZQBWQLJJMGJREB-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4S |
|---|---|
| Molecular weight | 239.21 g/mol |
| IUPAC name | N-[4-(5-nitrofuran-2-yl)-1,3-thiazol-2-yl]formamide |
| InChIKey | ZQBWQLJJMGJREB-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)[N+](=O)[O-])C2=CSC(=N2)NC=O |
Computed by PubChem (NCBI)