CAS 2455422-89-4 is the registry number for UA2239. Offered by: MedChemExpress. Available pack sizes: Get quote.
Disodium;2-amino-9-[(3R)-3-hydroxy-4-phosphonatobutyl]-1H-purin-6-one (CAS 2455422-89-4) is a chemical compound with the molecular formula C9H12N5Na2O5P and a molecular weight of 347.18 g/mol. IUPAC name: disodium;2-amino-9-[(3R)-3-hydroxy-4-phosphonatobutyl]-1H-purin-6-one. InChIKey: PFBZBAXUKWZVJG-ZJIMSODOSA-L.
| Molecular formula | C9H12N5Na2O5P |
|---|---|
| Molecular weight | 347.18 g/mol |
| IUPAC name | disodium;2-amino-9-[(3R)-3-hydroxy-4-phosphonatobutyl]-1H-purin-6-one |
| InChIKey | PFBZBAXUKWZVJG-ZJIMSODOSA-L |
| SMILES | C1=NC2=C(N1CC[C@H](CP(=O)([O-])[O-])O)N=C(NC2=O)N.[Na+].[Na+] |
Computed by PubChem (NCBI)