CAS 245550-64-5 appears in our catalog under these names: Glucoraphasatin potassium salt, Glucoraphasatin (potassium). Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 25 mg, 5 mg, 10 mg.
Potassium [(E)-[(E)-5-methylsulfanyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpent-4-enylidene]amino] sulfate (CAS 245550-64-5) is a chemical compound with the molecular formula C12H20KNO9S3 and a molecular weight of 457.6 g/mol. IUPAC name: potassium [(E)-[(E)-5-methylsulfanyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpent-4-enylidene]amino] sulfate. InChIKey: QCWTWIUVGNZTPK-JDYZUHCESA-M.
| Molecular formula | C12H20KNO9S3 |
|---|---|
| Molecular weight | 457.6 g/mol |
| IUPAC name | potassium [(E)-[(E)-5-methylsulfanyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpent-4-enylidene]amino] sulfate |
| InChIKey | QCWTWIUVGNZTPK-JDYZUHCESA-M |
| SMILES | CS/C=C/CC/C(=N\OS(=O)(=O)[O-])/SC1C(C(C(C(O1)CO)O)O)O.[K+] |
Computed by PubChem (NCBI)