CAS 2455508-17-3 appears in our catalog under these names: Glyoxalase I inhibitor 5, Glyoxalase I inhibitor 5, 98.38%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 2mg, 5 mg, 10 mg.
5-[(8-hydroxyquinolin-5-yl)diazenyl]-2-methylbenzenesulfonamide (CAS 2455508-17-3) is a chemical compound with the molecular formula C16H14N4O3S and a molecular weight of 342.4 g/mol. IUPAC name: 5-[(8-hydroxyquinolin-5-yl)diazenyl]-2-methylbenzenesulfonamide. InChIKey: HZHXXZUPMORJKH-UHFFFAOYSA-N.
| Molecular formula | C16H14N4O3S |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 5-[(8-hydroxyquinolin-5-yl)diazenyl]-2-methylbenzenesulfonamide |
| InChIKey | HZHXXZUPMORJKH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N=NC2=C3C=CC=NC3=C(C=C2)O)S(=O)(=O)N |
Computed by PubChem (NCBI)