CAS 2455508-31-1 is the registry number for Glyoxalase I inhibitor 7. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(4-amino-7-hydroxynaphthalen-1-yl)diazenyl]-2-methylbenzenesulfonamide (CAS 2455508-31-1) is a chemical compound with the molecular formula C17H16N4O3S and a molecular weight of 356.4 g/mol. IUPAC name: 5-[(4-amino-7-hydroxynaphthalen-1-yl)diazenyl]-2-methylbenzenesulfonamide. InChIKey: YZWDBEYFPIXISP-UHFFFAOYSA-N.
| Molecular formula | C17H16N4O3S |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 5-[(4-amino-7-hydroxynaphthalen-1-yl)diazenyl]-2-methylbenzenesulfonamide |
| InChIKey | YZWDBEYFPIXISP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N=NC2=C3C=C(C=CC3=C(C=C2)N)O)S(=O)(=O)N |
Computed by PubChem (NCBI)