Products 2456288-82-5
CAS 2456288-82-5 is the registry number for Antitumor agent-65. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
[(2R)-2-acetyloxy-2-[(2S,3R)-3-acetyloxy-6-oxo-2,3-dihydropyran-2-yl]ethyl] 4-nitrobenzoate (CAS 2456288-82-5) is a chemical compound with the molecular formula C18H17NO10 and a molecular weight of 407.3 g/mol. IUPAC name: [(2R)-2-acetyloxy-2-[(2S,3R)-3-acetyloxy-6-oxo-2,3-dihydropyran-2-yl]ethyl] 4-nitrobenzoate. InChIKey: JNROSBHHOCSGAO-INMHGKMJSA-N.
| Molecular formula | C18H17NO10 |
|---|---|
| Molecular weight | 407.3 g/mol |
| IUPAC name | [(2R)-2-acetyloxy-2-[(2S,3R)-3-acetyloxy-6-oxo-2,3-dihydropyran-2-yl]ethyl] 4-nitrobenzoate |
| InChIKey | JNROSBHHOCSGAO-INMHGKMJSA-N |
| SMILES | CC(=O)O[C@@H]1C=CC(=O)O[C@@H]1[C@@H](COC(=O)C2=CC=C(C=C2)[N+](=O)[O-])OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Antitumor agent-65, orb1688006