Products 2456348-60-8
CAS 2456348-60-8 appears in our catalog under these names: Photoswitchable sphingosine, Photoswitch sphingosine. Offered by: MedChemExpress, Sigma-Aldrich. Available pack sizes: Get quote, 1MG.
(E,2S,3R)-2-amino-7-[4-[(4-propylphenyl)diazenyl]phenyl]hept-4-ene-1,3-diol (CAS 2456348-60-8) is a chemical compound with the molecular formula C22H29N3O2 and a molecular weight of 367.5 g/mol. IUPAC name: (E,2S,3R)-2-amino-7-[4-[(4-propylphenyl)diazenyl]phenyl]hept-4-ene-1,3-diol. InChIKey: VAIVCUDKYOKMCB-BMQRCUTASA-N.
| Molecular formula | C22H29N3O2 |
|---|---|
| Molecular weight | 367.5 g/mol |
| IUPAC name | (E,2S,3R)-2-amino-7-[4-[(4-propylphenyl)diazenyl]phenyl]hept-4-ene-1,3-diol |
| InChIKey | VAIVCUDKYOKMCB-BMQRCUTASA-N |
| SMILES | CCCC1=CC=C(C=C1)N=NC2=CC=C(C=C2)CC/C=C/[C@H]([C@H](CO)N)O |
Computed by PubChem (NCBI)