Products 245650-17-3
CAS 245650-17-3 appears in our catalog under these names: Advantame, >95% (HPLC), Advantame, Advantame (free acid). Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 10 mg, 5 mg.
(3S)-3-[3-(3-hydroxy-4-methoxyphenyl)propylamino]-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid (CAS 245650-17-3) is a chemical compound with the molecular formula C24H30N2O7 and a molecular weight of 458.5 g/mol. IUPAC name: (3S)-3-[3-(3-hydroxy-4-methoxyphenyl)propylamino]-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid. InChIKey: YTKBWWKAVMSYHE-OALUTQOASA-N.
| Molecular formula | C24H30N2O7 |
|---|---|
| Molecular weight | 458.5 g/mol |
| IUPAC name | (3S)-3-[3-(3-hydroxy-4-methoxyphenyl)propylamino]-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| InChIKey | YTKBWWKAVMSYHE-OALUTQOASA-N |
| SMILES | COC1=C(C=C(C=C1)CCCN[C@@H](CC(=O)O)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)OC)O |
Computed by PubChem (NCBI)