CAS 245652-81-7 appears in our catalog under these names: Bis(cis-3,3,5-trimethylcyclohexyl) phthalate, 95%, Bis(cis–3,3,5–trimethylcyclohexyl) Phthalate, Bis(cis-3,3,5-trimethylcyclohexyl) Phthalate, >98.0%(GC), Bis(cis-3,3,5-trimethylcyclohexyl) phthalate, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg.
Bis[(1R,5R)-3,3,5-trimethylcyclohexyl] benzene-1,2-dicarboxylate (CAS 245652-81-7) is a chemical compound with the molecular formula C26H38O4 and a molecular weight of 414.6 g/mol. IUPAC name: bis[(1R,5R)-3,3,5-trimethylcyclohexyl] benzene-1,2-dicarboxylate. InChIKey: ATHBXDPWCKSOLE-VNTMZGSJSA-N.
| Molecular formula | C26H38O4 |
|---|---|
| Molecular weight | 414.6 g/mol |
| IUPAC name | bis[(1R,5R)-3,3,5-trimethylcyclohexyl] benzene-1,2-dicarboxylate |
| InChIKey | ATHBXDPWCKSOLE-VNTMZGSJSA-N |
| SMILES | C[C@H]1C[C@H](CC(C1)(C)C)OC(=O)C2=CC=CC=C2C(=O)O[C@@H]3C[C@@H](CC(C3)(C)C)C |
Computed by PubChem (NCBI)