CAS 2457316-06-0 appears in our catalog under these names: Indapamide Impurity 11, N-(4-Chloro-3-sulfamoylbenzoyl)-2-methylindoline, >95% (HPLC), N-(4-Chloro-3-sulfamoylbenzoyl)-2-methylindoline. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 100mg, 1g, 4x25mg, 25mg.
2-chloro-5-(2-methyl-2,3-dihydroindole-1-carbonyl)benzenesulfonamide (CAS 2457316-06-0) is a chemical compound with the molecular formula C16H15ClN2O3S and a molecular weight of 350.8 g/mol. IUPAC name: 2-chloro-5-(2-methyl-2,3-dihydroindole-1-carbonyl)benzenesulfonamide. InChIKey: WOUDRMJGGMLPFR-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O3S |
|---|---|
| Molecular weight | 350.8 g/mol |
| IUPAC name | 2-chloro-5-(2-methyl-2,3-dihydroindole-1-carbonyl)benzenesulfonamide |
| InChIKey | WOUDRMJGGMLPFR-UHFFFAOYSA-N |
| SMILES | CC1CC2=CC=CC=C2N1C(=O)C3=CC(=C(C=C3)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)