CAS 245765-92-8 is the registry number for 5-Bromo-3-methyl-2-(methyl-pivaloylamino)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(5-bromo-3-methyl-2-pyridinyl)-N,2,2-trimethylpropanamide (CAS 245765-92-8) is a chemical compound with the molecular formula C12H17BrN2O and a molecular weight of 285.18 g/mol. IUPAC name: N-(5-bromo-3-methyl-2-pyridinyl)-N,2,2-trimethylpropanamide. InChIKey: MKBZSCNCWLNWFH-UHFFFAOYSA-N.
| Molecular formula | C12H17BrN2O |
|---|---|
| Molecular weight | 285.18 g/mol |
| IUPAC name | N-(5-bromo-3-methyl-2-pyridinyl)-N,2,2-trimethylpropanamide |
| InChIKey | MKBZSCNCWLNWFH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1N(C)C(=O)C(C)(C)C)Br |
Computed by PubChem (NCBI)