CAS 24588-56-5 appears in our catalog under these names: 2-Heptanone-1,1,1,3,3-d5, 98 atom % D, min 98% Chemical Purity, 2–HEPTANONE–1,1,1,3,3–D5, 2-Heptanone-1,1,1,3,3-d5. Offered by: CDN, GLPBio, Biosynth. Available pack sizes: 1g, 10mg, 0,5g.
1,1,1,3,3-pentadeuterioheptan-2-one (CAS 24588-56-5) is a chemical compound with the molecular formula C7H14O and a molecular weight of 119.22 g/mol. IUPAC name: 1,1,1,3,3-pentadeuterioheptan-2-one. InChIKey: CATSNJVOTSVZJV-QKLSXCJMSA-N.
| Molecular formula | C7H14O |
|---|---|
| Molecular weight | 119.22 g/mol |
| IUPAC name | 1,1,1,3,3-pentadeuterioheptan-2-one |
| InChIKey | CATSNJVOTSVZJV-QKLSXCJMSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])CCCC |
Computed by PubChem (NCBI)