Products 2458816-05-0
CAS 2458816-05-0 is the registry number for 6-(2-Pyridinyl)-3-dibenzofurancarbonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g.
6-pyridin-2-yldibenzofuran-3-carbonitrile (CAS 2458816-05-0) is a chemical compound with the molecular formula C18H10N2O and a molecular weight of 270.3 g/mol. IUPAC name: 6-pyridin-2-yldibenzofuran-3-carbonitrile. InChIKey: QGPWVHOELPQVPP-UHFFFAOYSA-N.
| Molecular formula | C18H10N2O |
|---|---|
| Molecular weight | 270.3 g/mol |
| IUPAC name | 6-pyridin-2-yldibenzofuran-3-carbonitrile |
| InChIKey | QGPWVHOELPQVPP-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=CC3=C2OC4=C3C=CC(=C4)C#N |
Computed by PubChem (NCBI)