CAS 55368-37-1 appears in our catalog under these names: 4,4'-(2,5-Furandiyl)bis-benzonitrile, >95% (HPLC), 4,4'-(2,5-Furandiyl)bis-benzonitrile. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 50mg, 250mg, 100mg.
4-[5-(4-cyanophenyl)furan-2-yl]benzonitrile (CAS 55368-37-1) is a chemical compound with the molecular formula C18H10N2O and a molecular weight of 270.3 g/mol. IUPAC name: 4-[5-(4-cyanophenyl)furan-2-yl]benzonitrile. InChIKey: JVFLSYUMYIPFBA-UHFFFAOYSA-N.
| Molecular formula | C18H10N2O |
|---|---|
| Molecular weight | 270.3 g/mol |
| IUPAC name | 4-[5-(4-cyanophenyl)furan-2-yl]benzonitrile |
| InChIKey | JVFLSYUMYIPFBA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CC=C(O2)C3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)