Products 24591-52-4
CAS 24591-52-4 appears in our catalog under these names: H–Gly–Trp–Gly–Gly–OH, H-Gly-Trp-Gly-Gly-OH. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 500mg, 250mg, 1000mg.
2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]acetic acid (CAS 24591-52-4) is a chemical compound with the molecular formula C17H21N5O5 and a molecular weight of 375.4 g/mol. IUPAC name: 2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]acetic acid. InChIKey: RUSNQAKIOXZJMH-ZDUSSCGKSA-N.
| Molecular formula | C17H21N5O5 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]acetic acid |
| InChIKey | RUSNQAKIOXZJMH-ZDUSSCGKSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)NCC(=O)NCC(=O)O)NC(=O)CN |
Computed by PubChem (NCBI)