CAS 24598-73-0 appears in our catalog under these names: Potassium orotate, 97%, Potassium Orotate, >95% (HPLC), Orotic acid (potassium salt), Orotic acid potassium 98%, Potassium 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g, 500g, 5 g, 10 g.
Potassium 2,4-dioxo-1H-pyrimidine-6-carboxylate (CAS 24598-73-0) is a chemical compound with the molecular formula C5H3KN2O4 and a molecular weight of 194.19 g/mol. IUPAC name: potassium 2,4-dioxo-1H-pyrimidine-6-carboxylate. InChIKey: DHBUISJCVRMTAZ-UHFFFAOYSA-M.
| Molecular formula | C5H3KN2O4 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | potassium 2,4-dioxo-1H-pyrimidine-6-carboxylate |
| InChIKey | DHBUISJCVRMTAZ-UHFFFAOYSA-M |
| SMILES | C1=C(NC(=O)NC1=O)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)