CAS 2459946-38-2 appears in our catalog under these names: ((2-(Trimethylsilyl)ethoxy)carbonyl)-L-isoleucylglycine, 97%, Teoc-L-Ile-Gly-OH, 97%, 97%, Teoc-L-Ile-Gly-OH, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 2.5g.
2-[[(2S,3S)-3-methyl-2-(2-trimethylsilylethoxycarbonylamino)pentanoyl]amino]acetic acid (CAS 2459946-38-2) is a chemical compound with the molecular formula C14H28N2O5Si and a molecular weight of 332.47 g/mol. IUPAC name: 2-[[(2S,3S)-3-methyl-2-(2-trimethylsilylethoxycarbonylamino)pentanoyl]amino]acetic acid. InChIKey: VNEJVMKUFSPZGG-JQWIXIFHSA-N.
| Molecular formula | C14H28N2O5Si |
|---|---|
| Molecular weight | 332.47 g/mol |
| IUPAC name | 2-[[(2S,3S)-3-methyl-2-(2-trimethylsilylethoxycarbonylamino)pentanoyl]amino]acetic acid |
| InChIKey | VNEJVMKUFSPZGG-JQWIXIFHSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)NCC(=O)O)NC(=O)OCC[Si](C)(C)C |
Computed by PubChem (NCBI)