CAS 2459946-49-5 appears in our catalog under these names: (3R,4R)-1-Benzyl-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid hydrochloride, 95%, (3R,4R)-1-benzyl-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid hydrochloride, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
(3R,4R)-1-benzyl-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride (CAS 2459946-49-5) is a chemical compound with the molecular formula C18H19Cl2NO2 and a molecular weight of 352.3 g/mol. IUPAC name: (3R,4R)-1-benzyl-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: KXPXNHBOBQLZFO-QJHJCNPRSA-N.
| Molecular formula | C18H19Cl2NO2 |
|---|---|
| Molecular weight | 352.3 g/mol |
| IUPAC name | (3R,4R)-1-benzyl-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | KXPXNHBOBQLZFO-QJHJCNPRSA-N |
| SMILES | C1[C@H]([C@H](CN1CC2=CC=CC=C2)C(=O)O)C3=CC=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)