Products 2459950-15-1
CAS 2459950-15-1 is the registry number for DNA topoisomerase II inhibitor 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-(benzenesulfonyl)piperazin-1-yl]-(1-phenyl-9H-pyrido[3,4-b]indol-3-yl)methanone (CAS 2459950-15-1) is a chemical compound with the molecular formula C28H24N4O3S and a molecular weight of 496.6 g/mol. IUPAC name: [4-(benzenesulfonyl)piperazin-1-yl]-(1-phenyl-9H-pyrido[3,4-b]indol-3-yl)methanone. InChIKey: KYJLNQLOFWJHOQ-UHFFFAOYSA-N.
| Molecular formula | C28H24N4O3S |
|---|---|
| Molecular weight | 496.6 g/mol |
| IUPAC name | [4-(benzenesulfonyl)piperazin-1-yl]-(1-phenyl-9H-pyrido[3,4-b]indol-3-yl)methanone |
| InChIKey | KYJLNQLOFWJHOQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C(=O)C2=NC(=C3C(=C2)C4=CC=CC=C4N3)C5=CC=CC=C5)S(=O)(=O)C6=CC=CC=C6 |
Computed by PubChem (NCBI)
Synonyms:
DNA topoisomerase II inhibitor 1, orb1686683