Products 2460167-51-3
CAS 2460167-51-3 is the registry number for Anticancer agent 72. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(4-methylpiperazin-1-yl)-3-(4-nitrophenyl)-[1,2,4]triazolo[3,4-a]phthalazine (CAS 2460167-51-3) is a chemical compound with the molecular formula C20H19N7O2 and a molecular weight of 389.4 g/mol. IUPAC name: 6-(4-methylpiperazin-1-yl)-3-(4-nitrophenyl)-[1,2,4]triazolo[3,4-a]phthalazine. InChIKey: BZSZQLYSCIYBNH-UHFFFAOYSA-N.
| Molecular formula | C20H19N7O2 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | 6-(4-methylpiperazin-1-yl)-3-(4-nitrophenyl)-[1,2,4]triazolo[3,4-a]phthalazine |
| InChIKey | BZSZQLYSCIYBNH-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NN3C(=NN=C3C4=CC=CC=C42)C5=CC=C(C=C5)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 72, orb1688287