CAS 246022-36-6 is the registry number for Ethyl 2-((3-chloro-5-(trifluoromethyl)pyridin-2-yl)amino)acetate, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Ethyl 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]acetate (CAS 246022-36-6) is a chemical compound with the molecular formula C10H10ClF3N2O2 and a molecular weight of 282.64 g/mol. IUPAC name: ethyl 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]acetate. InChIKey: OYEGHBUYBPRZRE-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF3N2O2 |
|---|---|
| Molecular weight | 282.64 g/mol |
| IUPAC name | ethyl 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]acetate |
| InChIKey | OYEGHBUYBPRZRE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC1=C(C=C(C=N1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)