Products 2460281-94-9
CAS 2460281-94-9 is the registry number for Antifungal agent 20. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]thiourea (CAS 2460281-94-9) is a chemical compound with the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. IUPAC name: [(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]thiourea. InChIKey: OVUJOZUSCSTKGA-OOHIBURESA-N.
| Molecular formula | C11H19N3S |
|---|---|
| Molecular weight | 225.36 g/mol |
| IUPAC name | [(E)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]thiourea |
| InChIKey | OVUJOZUSCSTKGA-OOHIBURESA-N |
| SMILES | CC(=CCC/C(=C/C=N/NC(=S)N)/C)C |
Computed by PubChem (NCBI)