Products 2460433-24-1
CAS 2460433-24-1 appears in our catalog under these names: AB–FUBINACA metabolite 2A, AB–FUBINACA metabolite 2B. Offered by: GLPBio. Available pack sizes: 1mg, 5mg, 500μg.
4-amino-3-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-2-methyl-4-oxobutanoic acid (CAS 2460433-24-1) is a chemical compound with the molecular formula C20H19FN4O4 and a molecular weight of 398.4 g/mol. IUPAC name: 4-amino-3-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-2-methyl-4-oxobutanoic acid. InChIKey: NEZYQTIODXEXMK-UHFFFAOYSA-N.
| Molecular formula | C20H19FN4O4 |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | 4-amino-3-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-2-methyl-4-oxobutanoic acid |
| InChIKey | NEZYQTIODXEXMK-UHFFFAOYSA-N |
| SMILES | CC(C(C(=O)N)NC(=O)C1=NN(C2=CC=CC=C21)CC3=CC=C(C=C3)F)C(=O)O |
Computed by PubChem (NCBI)