Products 2460491-10-3
CAS 2460491-10-3 is the registry number for Methyl picolinate-d4. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 3,4,5,6-tetradeuteriopyridine-2-carboxylate (CAS 2460491-10-3) is a chemical compound with the molecular formula C7H7NO2 and a molecular weight of 141.16 g/mol. IUPAC name: methyl 3,4,5,6-tetradeuteriopyridine-2-carboxylate. InChIKey: NMMIHXMBOZYNET-QFFDRWTDSA-N.
| Molecular formula | C7H7NO2 |
|---|---|
| Molecular weight | 141.16 g/mol |
| IUPAC name | methyl 3,4,5,6-tetradeuteriopyridine-2-carboxylate |
| InChIKey | NMMIHXMBOZYNET-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])C(=O)OC)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Methyl picolinate-d4