Products 2460651-09-4
CAS 2460651-09-4 is the registry number for Antitubercular agent-27. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(4-bromo-1,3-dioxoisoindol-2-yl)pyridine-4-carboxamide (CAS 2460651-09-4) is a chemical compound with the molecular formula C14H8BrN3O3 and a molecular weight of 346.13 g/mol. IUPAC name: N-(4-bromo-1,3-dioxoisoindol-2-yl)pyridine-4-carboxamide. InChIKey: PTAYSFASQUXRSS-UHFFFAOYSA-N.
| Molecular formula | C14H8BrN3O3 |
|---|---|
| Molecular weight | 346.13 g/mol |
| IUPAC name | N-(4-bromo-1,3-dioxoisoindol-2-yl)pyridine-4-carboxamide |
| InChIKey | PTAYSFASQUXRSS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=O)N(C2=O)NC(=O)C3=CC=NC=C3 |
Computed by PubChem (NCBI)
Synonyms:
Antitubercular agent-27, orb1688897