CAS 2460730-12-3 is the registry number for MDMB–CHMICA metabolite M2. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
(2S)-2-[[1-(cyclohexylmethyl)indole-3-carbonyl]amino]-3,3-dimethylbutanoic acid (CAS 2460730-12-3) is a chemical compound with the molecular formula C22H30N2O3 and a molecular weight of 370.5 g/mol. IUPAC name: (2S)-2-[[1-(cyclohexylmethyl)indole-3-carbonyl]amino]-3,3-dimethylbutanoic acid. InChIKey: YFDOZUYCWXTPTF-LJQANCHMSA-N.
| Molecular formula | C22H30N2O3 |
|---|---|
| Molecular weight | 370.5 g/mol |
| IUPAC name | (2S)-2-[[1-(cyclohexylmethyl)indole-3-carbonyl]amino]-3,3-dimethylbutanoic acid |
| InChIKey | YFDOZUYCWXTPTF-LJQANCHMSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)NC(=O)C1=CN(C2=CC=CC=C21)CC3CCCCC3 |
Computed by PubChem (NCBI)