Products 2460924-63-2
CAS 2460924-63-2 is the registry number for Trk-IN-20. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazol-5-amine (CAS 2460924-63-2) is a chemical compound with the molecular formula C22H18F2N4 and a molecular weight of 376.4 g/mol. IUPAC name: N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazol-5-amine. InChIKey: ZHOXAGNPCZTRBN-HZRUHFOJSA-N.
| Molecular formula | C22H18F2N4 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazol-5-amine |
| InChIKey | ZHOXAGNPCZTRBN-HZRUHFOJSA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1)F)F)NC2=CC3=C(NN=C3C=C2)/C=C/C4=CC=CC=N4 |
Computed by PubChem (NCBI)
Synonyms:
Trk-IN-20, orb1688484