CAS 2461034-58-0 is the registry number for Potassium trifluoro(5-fluoro-2-hydroxyphenyl)borate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
Potassium trifluoro-(5-fluoro-2-hydroxyphenyl)boranuide (CAS 2461034-58-0) is a chemical compound with the molecular formula C6H4BF4KO and a molecular weight of 218.00 g/mol. IUPAC name: potassium trifluoro-(5-fluoro-2-hydroxyphenyl)boranuide. InChIKey: PKCIRTAPMRRUEX-UHFFFAOYSA-N.
| Molecular formula | C6H4BF4KO |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | potassium trifluoro-(5-fluoro-2-hydroxyphenyl)boranuide |
| InChIKey | PKCIRTAPMRRUEX-UHFFFAOYSA-N |
| SMILES | [B-](C1=C(C=CC(=C1)F)O)(F)(F)F.[K+] |
Computed by PubChem (NCBI)