CAS 246266-38-6 appears in our catalog under these names: 3–Geranyl–4–methoxybenzoic acid, 3-Geranyl-4-methoxybenzoic acid. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxybenzoic acid (CAS 246266-38-6) is a chemical compound with the molecular formula C18H24O3 and a molecular weight of 288.4 g/mol. IUPAC name: 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxybenzoic acid. InChIKey: IHSAYXMNBDVWDA-RIYZIHGNSA-N.
| Molecular formula | C18H24O3 |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxybenzoic acid |
| InChIKey | IHSAYXMNBDVWDA-RIYZIHGNSA-N |
| SMILES | CC(=CCC/C(=C/CC1=C(C=CC(=C1)C(=O)O)OC)/C)C |
Computed by PubChem (NCBI)