CAS 2463-84-5 appears in our catalog under these names: Dicapthon, 97%, Dicapthon, Isochlorthion, Dicapthon, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio, MedChemExpress. Available pack sizes: on request, 2,5g, 100mg, Get quote, 1x5ml.
(2-chloro-4-nitrophenoxy)-dimethoxy-sulfanylidene-lambda5-phosphane (CAS 2463-84-5) is a chemical compound with the molecular formula C8H9ClNO5PS and a molecular weight of 297.65 g/mol. IUPAC name: (2-chloro-4-nitrophenoxy)-dimethoxy-sulfanylidene-lambda5-phosphane. InChIKey: OTKXWJHPGBRXCR-UHFFFAOYSA-N.
| Molecular formula | C8H9ClNO5PS |
|---|---|
| Molecular weight | 297.65 g/mol |
| IUPAC name | (2-chloro-4-nitrophenoxy)-dimethoxy-sulfanylidene-lambda5-phosphane |
| InChIKey | OTKXWJHPGBRXCR-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)OC1=C(C=C(C=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)