Products 24632-70-0

CAS 24632-70-0 is the registry number for 1-Piperazineacetic acid, 4-(phenylmethyl)-, hydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(4-benzylpiperazin-1-yl)acetohydrazide (CAS 24632-70-0) is a chemical compound with the molecular formula C13H20N4O and a molecular weight of 248.32 g/mol. IUPAC name: 2-(4-benzylpiperazin-1-yl)acetohydrazide. InChIKey: HPORNZWVEBQIOT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20N4O
Molecular weight248.32 g/mol
IUPAC name2-(4-benzylpiperazin-1-yl)acetohydrazide
InChIKeyHPORNZWVEBQIOT-UHFFFAOYSA-N
SMILESC1CN(CCN1CC2=CC=CC=C2)CC(=O)NN

Computed by PubChem (NCBI)