CAS 24646-40-0 appears in our catalog under these names: 3,4–Methylenedioxy PV9 (hydrochloride), 1-(1,3-Benzodioxol-5-yl)-2-pyrrolidin-1-yloctan-1-one, hydrochloride, 3,4-Methylenedioxy PV9 (hydrochloride), 99%, 99%, 3,4-Methylenedioxy PV9 (hydrochloride), 99.90%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, 25 mg, 5 mg, 100 mg.
1-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-yloctan-1-one;hydrochloride (CAS 24646-40-0) is a chemical compound with the molecular formula C19H28ClNO3 and a molecular weight of 353.9 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-yloctan-1-one;hydrochloride. InChIKey: PYKXCYXCXKRYNZ-UHFFFAOYSA-N.
| Molecular formula | C19H28ClNO3 |
|---|---|
| Molecular weight | 353.9 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-yloctan-1-one;hydrochloride |
| InChIKey | PYKXCYXCXKRYNZ-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C(=O)C1=CC2=C(C=C1)OCO2)N3CCCC3.Cl |
Computed by PubChem (NCBI)