CAS 24647-20-9 appears in our catalog under these names: Dimethyl perfluoro-3,6-dioxaoctane-1,8-dioate, 95%, Dimethylperfluoro-3,6-dioxaoctane-1,8-dioate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
Methyl 2-[2-(1,1-difluoro-2-methoxy-2-oxoethoxy)-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroacetate (CAS 24647-20-9) is a chemical compound with the molecular formula C8H6F8O6 and a molecular weight of 350.12 g/mol. IUPAC name: methyl 2-[2-(1,1-difluoro-2-methoxy-2-oxoethoxy)-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroacetate. InChIKey: QSOLRJAJYGNQPD-UHFFFAOYSA-N.
| Molecular formula | C8H6F8O6 |
|---|---|
| Molecular weight | 350.12 g/mol |
| IUPAC name | methyl 2-[2-(1,1-difluoro-2-methoxy-2-oxoethoxy)-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroacetate |
| InChIKey | QSOLRJAJYGNQPD-UHFFFAOYSA-N |
| SMILES | COC(=O)C(OC(C(OC(C(=O)OC)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)