CAS 2465-91-0 appears in our catalog under these names: 6,6-Bis(4-cyano-2-oxabutyl)-4,8-dioxaundecane-1,11-dinitrile, 95%, Tetra(cyanoethoxymethyl) methane, Tetra(cyanoethoxymethyl) methane, Tetra(cyanoethoxymethyl) methane 99+%, Tetra(cyanoethoxymethyl) methane, 99+%, 99+%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 250 mg, 1 g, 100 mg.
3-[3-(2-cyanoethoxy)-2,2-bis(2-cyanoethoxymethyl)propoxy]propanenitrile (CAS 2465-91-0) is a chemical compound with the molecular formula C17H24N4O4 and a molecular weight of 348.4 g/mol. IUPAC name: 3-[3-(2-cyanoethoxy)-2,2-bis(2-cyanoethoxymethyl)propoxy]propanenitrile. InChIKey: KSXHZOTTWSNEHY-UHFFFAOYSA-N.
| Molecular formula | C17H24N4O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 3-[3-(2-cyanoethoxy)-2,2-bis(2-cyanoethoxymethyl)propoxy]propanenitrile |
| InChIKey | KSXHZOTTWSNEHY-UHFFFAOYSA-N |
| SMILES | C(COCC(COCCC#N)(COCCC#N)COCCC#N)C#N |
Computed by PubChem (NCBI)