CAS 24662-24-6 is the registry number for Benzo(b)thiophene-3-carbothioamide, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
1-benzothiophene-3-carbothioamide (CAS 24662-24-6) is a chemical compound with the molecular formula C9H7NS2 and a molecular weight of 193.3 g/mol. IUPAC name: 1-benzothiophene-3-carbothioamide. InChIKey: SQGQIBRTUHBEDB-UHFFFAOYSA-N.
| Molecular formula | C9H7NS2 |
|---|---|
| Molecular weight | 193.3 g/mol |
| IUPAC name | 1-benzothiophene-3-carbothioamide |
| InChIKey | SQGQIBRTUHBEDB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CS2)C(=S)N |
Computed by PubChem (NCBI)