Products 24677-84-7
CAS 24677-84-7 is the registry number for AHR-2244 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[4-[3-[4-(4-fluorobenzoyl)piperidin-1-ium-1-yl]propoxy]-3-methoxyphenyl]ethanone chloride (CAS 24677-84-7) is a chemical compound with the molecular formula C24H29ClFNO4 and a molecular weight of 449.9 g/mol. IUPAC name: 1-[4-[3-[4-(4-fluorobenzoyl)piperidin-1-ium-1-yl]propoxy]-3-methoxyphenyl]ethanone chloride. InChIKey: QUINACONPGHHMC-UHFFFAOYSA-N.
| Molecular formula | C24H29ClFNO4 |
|---|---|
| Molecular weight | 449.9 g/mol |
| IUPAC name | 1-[4-[3-[4-(4-fluorobenzoyl)piperidin-1-ium-1-yl]propoxy]-3-methoxyphenyl]ethanone chloride |
| InChIKey | QUINACONPGHHMC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)OCCC[NH+]2CCC(CC2)C(=O)C3=CC=C(C=C3)F)OC.[Cl-] |
Computed by PubChem (NCBI)