Products 2468771-62-0
CAS 2468771-62-0 appears in our catalog under these names: 3–Hydroxychrysene–d11, 3-Hydroxychrysene-d11. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 1 mg.
1,2,4,5,6,7,8,9,10,11,12-undecadeuteriochrysen-3-ol (CAS 2468771-62-0) is a chemical compound with the molecular formula C18H12O and a molecular weight of 255.4 g/mol. IUPAC name: 1,2,4,5,6,7,8,9,10,11,12-undecadeuteriochrysen-3-ol. InChIKey: PULKTNQKGZNFNB-LFFOKYCESA-N.
| Molecular formula | C18H12O |
|---|---|
| Molecular weight | 255.4 g/mol |
| IUPAC name | 1,2,4,5,6,7,8,9,10,11,12-undecadeuteriochrysen-3-ol |
| InChIKey | PULKTNQKGZNFNB-LFFOKYCESA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C3=C2C(=C(C4=C3C(=C(C(=C4[2H])[2H])O)[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)