Products 2469006-89-9
CAS 2469006-89-9 appears in our catalog under these names: Tebufenozide-d9, Tebufenozide-d9, >95% (HPLC), Tebufenozide-d9 (3,5-dimethylbenzoyl-d9), 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 25mg, 5mg, 0,05g, 0,01g, 1 mg.
N-tert-butyl-2,4,6-trideuterio-N'-(4-ethylbenzoyl)-3,5-bis(trideuteriomethyl)benzohydrazide (CAS 2469006-89-9) is a chemical compound with the molecular formula C22H28N2O2 and a molecular weight of 361.5 g/mol. IUPAC name: N-tert-butyl-2,4,6-trideuterio-N'-(4-ethylbenzoyl)-3,5-bis(trideuteriomethyl)benzohydrazide. InChIKey: QYPNKSZPJQQLRK-ZYICQLFUSA-N.
| Molecular formula | C22H28N2O2 |
|---|---|
| Molecular weight | 361.5 g/mol |
| IUPAC name | N-tert-butyl-2,4,6-trideuterio-N'-(4-ethylbenzoyl)-3,5-bis(trideuteriomethyl)benzohydrazide |
| InChIKey | QYPNKSZPJQQLRK-ZYICQLFUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])C([2H])([2H])[2H])[2H])C(=O)N(C(C)(C)C)NC(=O)C2=CC=C(C=C2)CC |
Computed by PubChem (NCBI)