Products 2469007-09-6
CAS 2469007-09-6 appears in our catalog under these names: Spirotetramat-d5, >95% (HPLC), Spirotetramat–d5. Offered by: TRC, GLPBio. Available pack sizes: 25mg, 50mg, 5mg, 1mg.
[3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] 1,1,2,2,2-pentadeuterioethyl carbonate (CAS 2469007-09-6) is a chemical compound with the molecular formula C21H27NO5 and a molecular weight of 378.5 g/mol. IUPAC name: [3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] 1,1,2,2,2-pentadeuterioethyl carbonate. InChIKey: CLSVJBIHYWPGQY-RPIBLTHZSA-N.
| Molecular formula | C21H27NO5 |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | [3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] 1,1,2,2,2-pentadeuterioethyl carbonate |
| InChIKey | CLSVJBIHYWPGQY-RPIBLTHZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)OC1=C(C(=O)NC12CCC(CC2)OC)C3=C(C=CC(=C3)C)C |
Computed by PubChem (NCBI)
Synonyms:
Spirotetramat-d5, Spirotetramat-d3