CAS 2469035-10-5 appears in our catalog under these names: 2-Methylbutyrylglycine-d2, (±)-N-(2-Methylbutyryl)glycine-2,2-d2, 98 atom % D, min 97% Chemical Purity, (±)-N-(2-Methylbutyryl)glycine-2,2-d2. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 5mg, 0,05g, 0,01g, 5 mg, 2.5 mg, 1 mg.
2,2-dideuterio-2-(2-methylbutanoylamino)acetic acid (CAS 2469035-10-5) is a chemical compound with the molecular formula C7H13NO3 and a molecular weight of 161.20 g/mol. IUPAC name: 2,2-dideuterio-2-(2-methylbutanoylamino)acetic acid. InChIKey: HOACIBQKYRHBOW-APZFVMQVSA-N.
| Molecular formula | C7H13NO3 |
|---|---|
| Molecular weight | 161.20 g/mol |
| IUPAC name | 2,2-dideuterio-2-(2-methylbutanoylamino)acetic acid |
| InChIKey | HOACIBQKYRHBOW-APZFVMQVSA-N |
| SMILES | [2H]C([2H])(C(=O)O)NC(=O)C(C)CC |
Computed by PubChem (NCBI)