CAS 2469040-04-6 is the registry number for Anastrozole Impurity 37. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-(1-amino-2-methyl-1-oxopropan-2-yl)-5-(1,2,4-triazol-4-ylmethyl)phenyl]-2-methylpropanoic acid (CAS 2469040-04-6) is a chemical compound with the molecular formula C17H22N4O3 and a molecular weight of 330.4 g/mol. IUPAC name: 2-[3-(1-amino-2-methyl-1-oxopropan-2-yl)-5-(1,2,4-triazol-4-ylmethyl)phenyl]-2-methylpropanoic acid. InChIKey: CLVIEZCHKBUOCW-UHFFFAOYSA-N.
| Molecular formula | C17H22N4O3 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 2-[3-(1-amino-2-methyl-1-oxopropan-2-yl)-5-(1,2,4-triazol-4-ylmethyl)phenyl]-2-methylpropanoic acid |
| InChIKey | CLVIEZCHKBUOCW-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC(=C1)CN2C=NN=C2)C(C)(C)C(=O)O)C(=O)N |
Computed by PubChem (NCBI)