CAS 2469195-92-2 appears in our catalog under these names: Bis(2–butoxyethyl) 2–hydroxyethyl phosphate–d4, Bis(2-butoxyethyl) 2-hydroxyethyl phosphate-d4. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
Bis(2-butoxyethyl) (1,1,2,2-tetradeuterio-2-hydroxyethyl) phosphate (CAS 2469195-92-2) is a chemical compound with the molecular formula C14H31O7P and a molecular weight of 346.39 g/mol. IUPAC name: bis(2-butoxyethyl) (1,1,2,2-tetradeuterio-2-hydroxyethyl) phosphate. InChIKey: UQSRKBXTCXVEJL-AQVLYMJBSA-N.
| Molecular formula | C14H31O7P |
|---|---|
| Molecular weight | 346.39 g/mol |
| IUPAC name | bis(2-butoxyethyl) (1,1,2,2-tetradeuterio-2-hydroxyethyl) phosphate |
| InChIKey | UQSRKBXTCXVEJL-AQVLYMJBSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])OP(=O)(OCCOCCCC)OCCOCCCC)O |
Computed by PubChem (NCBI)