CAS 2469274-10-8 appears in our catalog under these names: Mesotrione Impurity 1, 6-(Methylsulfonyl)-7-nitro-9-oxo-9H-xanthene-1-carbonitrile, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 25mg.
6-methylsulfonyl-7-nitro-9-oxoxanthene-1-carbonitrile (CAS 2469274-10-8) is a chemical compound with the molecular formula C15H8N2O6S and a molecular weight of 344.3 g/mol. IUPAC name: 6-methylsulfonyl-7-nitro-9-oxoxanthene-1-carbonitrile. InChIKey: ORMGQOLIUNXMEI-UHFFFAOYSA-N.
| Molecular formula | C15H8N2O6S |
|---|---|
| Molecular weight | 344.3 g/mol |
| IUPAC name | 6-methylsulfonyl-7-nitro-9-oxoxanthene-1-carbonitrile |
| InChIKey | ORMGQOLIUNXMEI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C2C(=C1)OC3=CC=CC(=C3C2=O)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)