CAS 2469554-07-0 appears in our catalog under these names: Bifonazole EP Impurity E, 4-Benzyl-1,1'-biphenyl Bifonazole. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
1,4-bis[phenyl-(4-phenylphenyl)methyl]imidazole (CAS 2469554-07-0) is a chemical compound with the molecular formula C41H32N2 and a molecular weight of 552.7 g/mol. IUPAC name: 1,4-bis[phenyl-(4-phenylphenyl)methyl]imidazole. InChIKey: GNKMHHWRXCPMFS-UHFFFAOYSA-N.
| Molecular formula | C41H32N2 |
|---|---|
| Molecular weight | 552.7 g/mol |
| IUPAC name | 1,4-bis[phenyl-(4-phenylphenyl)methyl]imidazole |
| InChIKey | GNKMHHWRXCPMFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(C3=CC=CC=C3)C4=CN(C=N4)C(C5=CC=CC=C5)C6=CC=C(C=C6)C7=CC=CC=C7 |
Computed by PubChem (NCBI)