Products 2470024-51-0
CAS 2470024-51-0 is the registry number for Apoptosis inducer 8. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[4-[[4-(1-benzyl-5-chlorobenzimidazol-2-yl)phenoxy]methyl]triazol-1-yl]phenol (CAS 2470024-51-0) is a chemical compound with the molecular formula C29H22ClN5O2 and a molecular weight of 508.0 g/mol. IUPAC name: 3-[4-[[4-(1-benzyl-5-chlorobenzimidazol-2-yl)phenoxy]methyl]triazol-1-yl]phenol. InChIKey: ODJNKXTWIBLBDO-UHFFFAOYSA-N.
| Molecular formula | C29H22ClN5O2 |
|---|---|
| Molecular weight | 508.0 g/mol |
| IUPAC name | 3-[4-[[4-(1-benzyl-5-chlorobenzimidazol-2-yl)phenoxy]methyl]triazol-1-yl]phenol |
| InChIKey | ODJNKXTWIBLBDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=C(C=C3)Cl)N=C2C4=CC=C(C=C4)OCC5=CN(N=N5)C6=CC(=CC=C6)O |
Computed by PubChem (NCBI)
Synonyms:
Apoptosis inducer 8, orb1686557