Products 247016-69-9
CAS 247016-69-9 appears in our catalog under these names: NVP DPP 728 dihydrochloride, DPP IV Inhibitor, NVP DPP 728, Nvp-728, ≥98%, ≥98%, NVP-DPP728, Nvp-728, ≥98%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 10mM (in 1ml dmso), 50mg, 25mg, 100mg, 1mg, Get quote.
6-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethylamino]pyridine-3-carbonitrile (CAS 247016-69-9) is a chemical compound with the molecular formula C15H18N6O and a molecular weight of 298.34 g/mol. IUPAC name: 6-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethylamino]pyridine-3-carbonitrile. InChIKey: VFFZWMWTUSXDCB-ZDUSSCGKSA-N.
| Molecular formula | C15H18N6O |
|---|---|
| Molecular weight | 298.34 g/mol |
| IUPAC name | 6-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethylamino]pyridine-3-carbonitrile |
| InChIKey | VFFZWMWTUSXDCB-ZDUSSCGKSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)CNCCNC2=NC=C(C=C2)C#N)C#N |
Computed by PubChem (NCBI)