CAS 2470440-89-0 is the registry number for Lithium 5-chlorothiazole-2-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Lithium 5-chloro-1,3-thiazole-2-carboxylate (CAS 2470440-89-0) is a chemical compound with the molecular formula C4HClLiNO2S and a molecular weight of 169.5 g/mol. IUPAC name: lithium 5-chloro-1,3-thiazole-2-carboxylate. InChIKey: RZYBJTVJLQSXMW-UHFFFAOYSA-M.
| Molecular formula | C4HClLiNO2S |
|---|---|
| Molecular weight | 169.5 g/mol |
| IUPAC name | lithium 5-chloro-1,3-thiazole-2-carboxylate |
| InChIKey | RZYBJTVJLQSXMW-UHFFFAOYSA-M |
| SMILES | [Li+].C1=C(SC(=N1)C(=O)[O-])Cl |
Computed by PubChem (NCBI)