Products 247061-07-0
CAS 247061-07-0 is the registry number for 3-Nitro Ropivacaine. Offered by: TRC. Available pack sizes: 500mg, 50mg.
(2S)-N-(2,6-dimethyl-3-nitrophenyl)-1-propylpiperidine-2-carboxamide (CAS 247061-07-0) is a chemical compound with the molecular formula C17H25N3O3 and a molecular weight of 319.4 g/mol. IUPAC name: (2S)-N-(2,6-dimethyl-3-nitrophenyl)-1-propylpiperidine-2-carboxamide. InChIKey: KRANSHYISPICMC-HNNXBMFYSA-N.
| Molecular formula | C17H25N3O3 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | (2S)-N-(2,6-dimethyl-3-nitrophenyl)-1-propylpiperidine-2-carboxamide |
| InChIKey | KRANSHYISPICMC-HNNXBMFYSA-N |
| SMILES | CCCN1CCCC[C@H]1C(=O)NC2=C(C=CC(=C2C)[N+](=O)[O-])C |
Computed by PubChem (NCBI)