CAS 247068-84-4 appears in our catalog under these names: Carfilzomib Impurity 31, Carfilzomib Impurity 44, (2S)-2-Amino-4-methyl-1-((2R)-2-methyloxiranyl)-1-pentanone Trifluoroacetate. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S)-2-amino-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentan-1-one (CAS 247068-84-4) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: (2S)-2-amino-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentan-1-one. InChIKey: ASROSKVBCYFAHU-IONNQARKSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | (2S)-2-amino-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentan-1-one |
| InChIKey | ASROSKVBCYFAHU-IONNQARKSA-N |
| SMILES | CC(C)C[C@@H](C(=O)[C@]1(CO1)C)N |
Computed by PubChem (NCBI)