Products 2470969-91-4
CAS 2470969-91-4 appears in our catalog under these names: SIRT1-IN-3, 99.12%, SIRT1-IN-3, 99%. Offered by: MedChemExpress, Chemat. Available pack sizes: 10 mg, 100 mg, 10mM/1mL, 5 mg, 50 mg, 25 mg, 5mg, 10mg.
2-(5-bromo-3-propan-2-yl-1H-indol-2-yl)acetamide (CAS 2470969-91-4) is a chemical compound with the molecular formula C13H15BrN2O and a molecular weight of 295.17 g/mol. IUPAC name: 2-(5-bromo-3-propan-2-yl-1H-indol-2-yl)acetamide. InChIKey: VBWIUUXBNGYYGO-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2O |
|---|---|
| Molecular weight | 295.17 g/mol |
| IUPAC name | 2-(5-bromo-3-propan-2-yl-1H-indol-2-yl)acetamide |
| InChIKey | VBWIUUXBNGYYGO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(NC2=C1C=C(C=C2)Br)CC(=O)N |
Computed by PubChem (NCBI)